C17H25FN2O3 — CID 42934625
propan-2-yl 3-[[1-(4-fluorophenyl)-2-methylpropyl]carbamoylamino]propanoate (PubChem CID 42934625) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is propan-2-yl 3-[[1-(4-fluorophenyl)-2-methylpropyl]carbamoylamino]propanoate.
| Compound Name | propan-2-yl 3-[[1-(4-fluorophenyl)-2-methylpropyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 42934625 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | propan-2-yl 3-[[1-(4-fluorophenyl)-2-methylpropyl]carbamoylamino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)NC(c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C17H25FN2O3/c1-11(2)16(13-5-7-14(18)8-6-13)20-17(22)19-10-9-15(21)23-12(3)4/h5-8,11-12,16H,9-10H2,1-4H3,(H2,19,20,22) |
| InChIKey | MJKSQOVCXJQITQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |