C21H19FN4O2S2 — CID 42936223
3-(2-fluorophenyl)-7-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 42936223) has the molecular formula C21H19FN4O2S2 and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-7-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-fluorophenyl)-7-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42936223 |
| Molecular Formula | C21H19FN4O2S2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 3-(2-fluorophenyl)-7-methyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1noc(CSc2nc3sc4c(c3c(=O)n2-c2ccccc2F)CCC(C)C4)n1 |
| InChI | InChI=1S/C21H19FN4O2S2/c1-11-7-8-13-16(9-11)30-19-18(13)20(27)26(15-6-4-3-5-14(15)22)21(24-19)29-10-17-23-12(2)25-28-17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | KUYGVYHABQHQMV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |