C21H17F3N4O2S2 — CID 55516454
2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 55516454) has the molecular formula C21H17F3N4O2S2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55516454 |
| Molecular Formula | C21H17F3N4O2S2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1noc(CSc2nc3sc4c(c3c(=O)n2-c2cccc(C(F)(F)F)c2)CCCC4)n1 |
| InChI | InChI=1S/C21H17F3N4O2S2/c1-11-25-16(30-27-11)10-31-20-26-18-17(14-7-2-3-8-15(14)32-18)19(29)28(20)13-6-4-5-12(9-13)21(22,23)24/h4-6,9H,2-3,7-8,10H2,1H3 |
| InChIKey | CMGUSKHFIHEFNX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |