C33H32ClFN4O4S — CID 42936252
4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-(3-morpholin-4-ylphenyl)ethylideneamino]benzamide (PubChem CID 42936252) has the molecular formula C33H32ClFN4O4S and a molecular weight of 635.16 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-(3-morpholin-4-ylphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-(3-morpholin-4-ylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 42936252 |
| Molecular Formula | C33H32ClFN4O4S |
| Molecular Weight | 635.16 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-(3-morpholin-4-ylphenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C33H32ClFN4O4S/c1-24(28-3-2-4-31(21-28)38-17-19-43-20-18-38)36-37-33(40)27-9-5-25(6-10-27)22-39(23-26-7-13-30(35)14-8-26)44(41,42)32-15-11-29(34)12-16-32/h2-16,21H,17-20,22-23H2,1H3,(H,37,40)/b36-24+ |
| InChIKey | IWMKOFYWXKTVQT-XBQJKBNESA-N |
| XLogP | 5.86 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.16 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|