C28H24ClFN4O3S — CID 42936240
4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-pyridin-3-ylethylideneamino]benzamide (PubChem CID 42936240) has the molecular formula C28H24ClFN4O3S and a molecular weight of 551.04 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-pyridin-3-ylethylideneamino]benzamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-pyridin-3-ylethylideneamino]benzamide |
|---|---|
| PubChem CID | 42936240 |
| Molecular Formula | C28H24ClFN4O3S |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[(E)-1-pyridin-3-ylethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1)c1cccnc1 |
| InChI | InChI=1S/C28H24ClFN4O3S/c1-20(24-3-2-16-31-17-24)32-33-28(35)23-8-4-21(5-9-23)18-34(19-22-6-12-26(30)13-7-22)38(36,37)27-14-10-25(29)11-15-27/h2-17H,18-19H2,1H3,(H,33,35)/b32-20+ |
| InChIKey | KNQWZVIECZSPPJ-UZWMFBFFSA-N |
| XLogP | 5.42 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|