C22H29N3O3S — CID 42937091
N-[1-(1-adamantyl)ethyl]-2-(3-cyano-N-methylsulfonylanilino)acetamide (PubChem CID 42937091) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(3-cyano-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(3-cyano-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 42937091 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(3-cyano-N-methylsulfonylanilino)acetamide |
| SMILES | CC(NC(=O)CN(c1cccc(C#N)c1)S(C)(=O)=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29N3O3S/c1-15(22-10-17-6-18(11-22)8-19(7-17)12-22)24-21(26)14-25(29(2,27)28)20-5-3-4-16(9-20)13-23/h3-5,9,15,17-19H,6-8,10-12,14H2,1-2H3,(H,24,26) |
| InChIKey | YVPQPDMFAQJSKP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |