C27H31N3O3S — CID 45351359
N-[1-(1-adamantyl)ethyl]-2-(N-(3-cyanophenyl)sulfonylanilino)acetamide (PubChem CID 45351359) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(N-(3-cyanophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(N-(3-cyanophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 45351359 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(N-(3-cyanophenyl)sulfonylanilino)acetamide |
| SMILES | CC(NC(=O)CN(c1ccccc1)S(=O)(=O)c1cccc(C#N)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H31N3O3S/c1-19(27-14-21-10-22(15-27)12-23(11-21)16-27)29-26(31)18-30(24-7-3-2-4-8-24)34(32,33)25-9-5-6-20(13-25)17-28/h2-9,13,19,21-23H,10-12,14-16,18H2,1H3,(H,29,31) |
| InChIKey | MDQVMAHVLLQXTL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |