C21H18N2O5S — CID 42938587
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 42938587) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 42938587 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OCc1csc(-c2ccco2)n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H18N2O5S/c1-12(2)17(23-19(24)14-6-3-4-7-15(14)20(23)25)21(26)28-10-13-11-29-18(22-13)16-8-5-9-27-16/h3-9,11-12,17H,10H2,1-2H3 |
| InChIKey | QXPOFLOHLXGHIJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|