C19H18N2O4S — CID 55529422
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-benzamidobutanoate (PubChem CID 55529422) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-benzamidobutanoate.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55529422 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCc1csc(-c2ccco2)n1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-13(20-18(23)14-6-3-2-4-7-14)10-17(22)25-11-15-12-26-19(21-15)16-8-5-9-24-16/h2-9,12-13H,10-11H2,1H3,(H,20,23) |
| InChIKey | UZNZKFHCUWMXMJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |