C47H48F2N2O4 — CID 4294013
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea (PubChem CID 4294013) has the molecular formula C47H48F2N2O4 and a molecular weight of 742.91 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4294013 |
| Molecular Formula | C47H48F2N2O4 |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 742.36 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1cccc2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C47H48F2N2O4/c1-43-20-17-34(52)26-45(43)23-24-47(36(27-45)41(53)31-15-16-37(48)38(49)25-31)39(43)18-21-44(2)40(47)19-22-46(44,55)29-51(42(54)50-33-12-4-3-5-13-33)28-32-11-8-10-30-9-6-7-14-35(30)32/h3-16,23-25,27,34,39-40,52,55H,17-22,26,28-29H2,1-2H3,(H,50,54) |
| InChIKey | FDWNASUNUWHGQT-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|