C48H49F3N2O4 — CID 4294015
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea (PubChem CID 4294015) has the molecular formula C48H49F3N2O4 and a molecular weight of 774.92 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4294015 |
| Molecular Formula | C48H49F3N2O4 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1cccc2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C48H49F3N2O4/c1-43-21-18-36(54)27-45(43)24-25-47(38(28-45)41(55)32-12-9-14-34(26-32)48(49,50)51)39(43)19-22-44(2)40(47)20-23-46(44,57)30-53(42(56)52-35-15-4-3-5-16-35)29-33-13-8-11-31-10-6-7-17-37(31)33/h3-17,24-26,28,36,39-40,54,57H,18-23,27,29-30H2,1-2H3,(H,52,56) |
| InChIKey | SPMRPKCVCUWUTD-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|