C25H23N3O2 — CID 42940820
(E)-N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 42940820) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (E)-N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 42940820 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (E)-N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)NC(c2ccccc2)c2ccc3nc[nH]c3c2)o1 |
| InChI | InChI=1S/C25H23N3O2/c1-16-13-20(16)23-11-8-19(30-23)9-12-24(29)28-25(17-5-3-2-4-6-17)18-7-10-21-22(14-18)27-15-26-21/h2-12,14-16,20,25H,13H2,1H3,(H,26,27)(H,28,29)/b12-9+ |
| InChIKey | KNSLOEKPQSXQAP-FMIVXFBMSA-N |
| XLogP | 5.20 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|