C15H10ClF3N2O4S2 — CID 42942032
N-[2-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 42942032) has the molecular formula C15H10ClF3N2O4S2 and a molecular weight of 438.84 g/mol. Its IUPAC name is N-[2-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[2-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 42942032 |
| Molecular Formula | C15H10ClF3N2O4S2 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | N-[2-(1-chloro-2,2,2-trifluoroethyl)sulfanylphenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Nc3ccccc3SC(Cl)C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C15H10ClF3N2O4S2/c16-13(15(17,18)19)26-12-4-2-1-3-10(12)21-27(23,24)8-5-6-9-11(7-8)25-14(22)20-9/h1-7,13,21H,(H,20,22) |
| InChIKey | QRSCSAZNGLCGOF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|