C16H14N2O6S — CID 94109831
ethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]benzoate (PubChem CID 94109831) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is ethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 94109831 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | ethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C16H14N2O6S/c1-2-23-15(19)11-5-3-4-6-12(11)18-25(21,22)10-7-8-13-14(9-10)24-16(20)17-13/h3-9,18H,2H2,1H3,(H,17,20) |
| InChIKey | WVYIDCCWFVJVDL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |