C17H15N3O5S — CID 46680428
2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-N-prop-2-enylbenzamide (PubChem CID 46680428) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 46680428 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NS(=O)(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-2-9-18-16(21)12-5-3-4-6-13(12)20-26(23,24)11-7-8-14-15(10-11)25-17(22)19-14/h2-8,10,20H,1,9H2,(H,18,21)(H,19,22) |
| InChIKey | ZVYISJCENIBBMN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|