C21H23N3O6S — CID 42942582
1-[2-[(1,1-dioxothiolan-3-yl)methyl]benzimidazol-1-yl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 42942582) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothiolan-3-yl)methyl]benzimidazol-1-yl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[2-[(1,1-dioxothiolan-3-yl)methyl]benzimidazol-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 42942582 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-[2-[(1,1-dioxothiolan-3-yl)methyl]benzimidazol-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OCC(O)Cn2c(CC3CCS(=O)(=O)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C21H23N3O6S/c25-17(13-30-18-5-3-4-16(11-18)24(26)27)12-23-20-7-2-1-6-19(20)22-21(23)10-15-8-9-31(28,29)14-15/h1-7,11,15,17,25H,8-10,12-14H2 |
| InChIKey | XCTNYSASHRLSJR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|