C25H20FNO5 — CID 42943945
[4-(4-fluorobenzoyl)phenyl] 3-(oxolane-2-carbonylamino)benzoate (PubChem CID 42943945) has the molecular formula C25H20FNO5 and a molecular weight of 433.44 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 3-(oxolane-2-carbonylamino)benzoate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 3-(oxolane-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 42943945 |
| Molecular Formula | C25H20FNO5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 3-(oxolane-2-carbonylamino)benzoate |
| SMILES | O=C(Oc1ccc(C(=O)c2ccc(F)cc2)cc1)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C25H20FNO5/c26-19-10-6-16(7-11-19)23(28)17-8-12-21(13-9-17)32-25(30)18-3-1-4-20(15-18)27-24(29)22-5-2-14-31-22/h1,3-4,6-13,15,22H,2,5,14H2,(H,27,29) |
| InChIKey | RPZFFVJGTKZCQL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|