C18H15BrClNO4 — CID 43049708
(2-bromo-4-chlorophenyl) 3-(oxolane-2-carbonylamino)benzoate (PubChem CID 43049708) has the molecular formula C18H15BrClNO4 and a molecular weight of 424.68 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 3-(oxolane-2-carbonylamino)benzoate.
| Compound Name | (2-bromo-4-chlorophenyl) 3-(oxolane-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 43049708 |
| Molecular Formula | C18H15BrClNO4 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 3-(oxolane-2-carbonylamino)benzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1Br)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C18H15BrClNO4/c19-14-10-12(20)6-7-15(14)25-18(23)11-3-1-4-13(9-11)21-17(22)16-5-2-8-24-16/h1,3-4,6-7,9-10,16H,2,5,8H2,(H,21,22) |
| InChIKey | BVXGNBUHHXJNHE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|