C21H30N2O2 — CID 42946351
(E)-N'-cyclohexyl-N'-methyl-N-(2-methyl-1-phenylpropyl)but-2-enediamide (PubChem CID 42946351) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (E)-N'-cyclohexyl-N'-methyl-N-(2-methyl-1-phenylpropyl)but-2-enediamide.
| Compound Name | (E)-N'-cyclohexyl-N'-methyl-N-(2-methyl-1-phenylpropyl)but-2-enediamide |
|---|---|
| PubChem CID | 42946351 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (E)-N'-cyclohexyl-N'-methyl-N-(2-methyl-1-phenylpropyl)but-2-enediamide |
| SMILES | CC(C)C(NC(=O)/C=C/C(=O)N(C)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2/c1-16(2)21(17-10-6-4-7-11-17)22-19(24)14-15-20(25)23(3)18-12-8-5-9-13-18/h4,6-7,10-11,14-16,18,21H,5,8-9,12-13H2,1-3H3,(H,22,24)/b15-14+ |
| InChIKey | HULIGYWZUZLVLF-CCEZHUSRSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|