C17H21FNO3P — CID 42948672
[(3-fluoro-4-methylanilino)-(4-propan-2-ylphenyl)methyl]phosphonic acid (PubChem CID 42948672) has the molecular formula C17H21FNO3P and a molecular weight of 337.33 g/mol. Its IUPAC name is [(3-fluoro-4-methylanilino)-(4-propan-2-ylphenyl)methyl]phosphonic acid.
| Compound Name | [(3-fluoro-4-methylanilino)-(4-propan-2-ylphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 42948672 |
| Molecular Formula | C17H21FNO3P |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [(3-fluoro-4-methylanilino)-(4-propan-2-ylphenyl)methyl]phosphonic acid |
| SMILES | Cc1ccc(NC(c2ccc(C(C)C)cc2)P(=O)(O)O)cc1F |
| InChI | InChI=1S/C17H21FNO3P/c1-11(2)13-5-7-14(8-6-13)17(23(20,21)22)19-15-9-4-12(3)16(18)10-15/h4-11,17,19H,1-3H3,(H2,20,21,22) |
| InChIKey | QSVQBTGIFVSMHU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|