C16H19ClF3N3O2 — CID 42955553
N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 42955553) has the molecular formula C16H19ClF3N3O2 and a molecular weight of 377.79 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42955553 |
| Molecular Formula | C16H19ClF3N3O2 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-3-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCNC(=O)N1CCCC(C(F)(F)F)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClF3N3O2/c17-13-5-3-11(4-6-13)14(24)21-7-8-22-15(25)23-9-1-2-12(10-23)16(18,19)20/h3-6,12H,1-2,7-10H2,(H,21,24)(H,22,25) |
| InChIKey | UXZWBKIMNPJKMI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|