C23H23N5OS2 — CID 42962395
(E)-1-[4-[(5-methyl-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinolin-2-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 42962395) has the molecular formula C23H23N5OS2 and a molecular weight of 449.61 g/mol. Its IUPAC name is (E)-1-[4-[(5-methyl-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinolin-2-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(5-methyl-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinolin-2-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 42962395 |
| Molecular Formula | C23H23N5OS2 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (E)-1-[4-[(5-methyl-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinolin-2-yl)methyl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | Cc1cc2nn(CN3CCN(C(=O)/C=C/c4cccs4)CC3)c(=S)n2c2ccccc12 |
| InChI | InChI=1S/C23H23N5OS2/c1-17-15-21-24-27(23(30)28(21)20-7-3-2-6-19(17)20)16-25-10-12-26(13-11-25)22(29)9-8-18-5-4-14-31-18/h2-9,14-15H,10-13,16H2,1H3/b9-8+ |
| InChIKey | MTYJIIIKNWYFEC-CMDGGOBGSA-N |
| XLogP | 4.20 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|