C20H21NO7 — CID 42964078
3-O,5-O-dimethyl 4-O-phenacyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 42964078) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-O,5-O-dimethyl 4-O-phenacyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-dimethyl 4-O-phenacyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 42964078 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-O,5-O-dimethyl 4-O-phenacyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO7/c1-11-15(18(23)26-3)17(16(12(2)21-11)19(24)27-4)20(25)28-10-14(22)13-8-6-5-7-9-13/h5-9,17,21H,10H2,1-4H3 |
| InChIKey | YCETXXIFGBETNE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|