C21H23ClN2O5S2 — CID 42965497
[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 42965497) has the molecular formula C21H23ClN2O5S2 and a molecular weight of 483.01 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 42965497 |
| Molecular Formula | C21H23ClN2O5S2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | O=C(CCSc1ccc(Cl)cc1)OCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O5S2/c22-17-6-8-18(9-7-17)30-15-10-21(26)29-16-20(25)23-11-13-24(14-12-23)31(27,28)19-4-2-1-3-5-19/h1-9H,10-16H2 |
| InChIKey | WNSJSQSWQALFPZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |