C8H11NO — CID 4296719
(4,6-dimethyl-2-pyridinyl)methanol (PubChem CID 4296719) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (4,6-dimethyl-2-pyridinyl)methanol.
| Compound Name | (4,6-dimethyl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 4296719 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (4,6-dimethyl-2-pyridinyl)methanol |
| SMILES | Cc1cc(C)nc(CO)c1 |
| InChI | InChI=1S/C8H11NO/c1-6-3-7(2)9-8(4-6)5-10/h3-4,10H,5H2,1-2H3 |
| InChIKey | VKQZCYMDNLIADD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |