C22H16ClF2NO5S — CID 42967337
[2-(2,5-difluorophenyl)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate (PubChem CID 42967337) has the molecular formula C22H16ClF2NO5S and a molecular weight of 479.89 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 42967337 |
| Molecular Formula | C22H16ClF2NO5S |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
| SMILES | O=C(OCC(=O)c1cc(F)ccc1F)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H16ClF2NO5S/c23-18-8-6-15(10-21(18)32(29,30)26-12-14-4-2-1-3-5-14)22(28)31-13-20(27)17-11-16(24)7-9-19(17)25/h1-11,26H,12-13H2 |
| InChIKey | AVJVTZXMIMEHMG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |