C20H20N2O4 — CID 42967704
methyl 4-[(E)-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethoxy]iminomethyl]benzoate (PubChem CID 42967704) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 4-[(E)-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethoxy]iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethoxy]iminomethyl]benzoate |
|---|---|
| PubChem CID | 42967704 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl 4-[(E)-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethoxy]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/OCC(=O)N2c3ccccc3CC2C)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-14-11-17-5-3-4-6-18(17)22(14)19(23)13-26-21-12-15-7-9-16(10-8-15)20(24)25-2/h3-10,12,14H,11,13H2,1-2H3/b21-12+ |
| InChIKey | FKBAFLRDGJDHAD-CIAFOILYSA-N |
| XLogP | 2.80 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|