C18H17FN2O2 — CID 7703224
2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 7703224) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 7703224 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)CO/N=C\c1ccccc1F |
| InChI | InChI=1S/C18H17FN2O2/c1-13-10-14-6-3-5-9-17(14)21(13)18(22)12-23-20-11-15-7-2-4-8-16(15)19/h2-9,11,13H,10,12H2,1H3/b20-11-/t13-/m1/s1 |
| InChIKey | ZYTQEWDKEZYFJZ-RBFBNPFJSA-N |
| XLogP | 3.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|