C18H19NO4 — CID 42969454
[1-(benzylamino)-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate (PubChem CID 42969454) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is [1-(benzylamino)-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [1-(benzylamino)-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 42969454 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [1-(benzylamino)-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)NCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C18H19NO4/c1-12-8-9-15(16(20)10-12)18(22)23-13(2)17(21)19-11-14-6-4-3-5-7-14/h3-10,13,20H,11H2,1-2H3,(H,19,21) |
| InChIKey | QZGSEMWWOMGZLT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |