C23H27N5O2 — CID 4297016
3-N,3-N-diethyl-1-N-(1,9-phenanthrolin-5-yl)piperidine-1,3-dicarboxamide (PubChem CID 4297016) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N-(1,9-phenanthrolin-5-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-diethyl-1-N-(1,9-phenanthrolin-5-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 4297016 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3-N,3-N-diethyl-1-N-(1,9-phenanthrolin-5-yl)piperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)Nc2cc3ccncc3c3ncccc23)C1 |
| InChI | InChI=1S/C23H27N5O2/c1-3-27(4-2)22(29)17-7-6-12-28(15-17)23(30)26-20-13-16-9-11-24-14-19(16)21-18(20)8-5-10-25-21/h5,8-11,13-14,17H,3-4,6-7,12,15H2,1-2H3,(H,26,30) |
| InChIKey | ADCGBFOEFASIJK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|