C22H24N2O7 — CID 42976139
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate (PubChem CID 42976139) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 42976139 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)CN1C(=O)C2CC=CCC2C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O7/c1-2-30-19(26)12-23(15-8-4-3-5-9-15)18(25)14-31-20(27)13-24-21(28)16-10-6-7-11-17(16)22(24)29/h3-9,16-17H,2,10-14H2,1H3 |
| InChIKey | HLYBEEWVUNJOOO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|