C23H23NO4 — CID 42978023
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 42978023) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42978023 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | Cc1cc(C)c(C(=O)C(C)OC(=O)/C=C/c2ccc(OCC#N)cc2)cc1C |
| InChI | InChI=1S/C23H23NO4/c1-15-13-17(3)21(14-16(15)2)23(26)18(4)28-22(25)10-7-19-5-8-20(9-6-19)27-12-11-24/h5-10,13-14,18H,12H2,1-4H3/b10-7+ |
| InChIKey | ZJRBOQPPOOIJDH-JXMROGBWSA-N |
| XLogP | 4.34 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|