C19H19N3O5 — CID 42979044
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate (PubChem CID 42979044) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 42979044 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCn1nc(C(=O)OCC(=O)N(C)Cc2ccco2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H19N3O5/c1-3-22-18(24)15-9-5-4-8-14(15)17(20-22)19(25)27-12-16(23)21(2)11-13-7-6-10-26-13/h4-10H,3,11-12H2,1-2H3 |
| InChIKey | QHWHHSKBCVLZIK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |