C18H17N3O5 — CID 7675404
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 7675404) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7675404 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | CN(Cc1ccco1)C(=O)COC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H17N3O5/c1-20(10-12-6-5-9-25-12)15(22)11-26-18(24)16-13-7-3-4-8-14(13)17(23)21(2)19-16/h3-9H,10-11H2,1-2H3 |
| InChIKey | QKTPYPSGUVFTAQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |