C25H20N4O5 — CID 42985536
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 42985536) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42985536 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CCC2=O)cc1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N4O5/c30-22(26-18-8-10-20(11-9-18)28-27-19-4-2-1-3-5-19)16-34-25(33)17-6-12-21(13-7-17)29-23(31)14-15-24(29)32/h1-13H,14-16H2,(H,26,30)/b28-27+ |
| InChIKey | LQTNQKOXOLNPIJ-BYYHNAKLSA-N |
| XLogP | 4.55 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|