C18H34N4O5S — CID 4298614
ethyl 4-[3-(3-methylbutylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate (PubChem CID 4298614) has the molecular formula C18H34N4O5S and a molecular weight of 418.56 g/mol. Its IUPAC name is ethyl 4-[3-(3-methylbutylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3-methylbutylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 4298614 |
| Molecular Formula | C18H34N4O5S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | ethyl 4-[3-(3-methylbutylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)N2CCCC(C(=O)NCCC(C)C)C2)CC1 |
| InChI | InChI=1S/C18H34N4O5S/c1-4-27-18(24)20-10-12-21(13-11-20)28(25,26)22-9-5-6-16(14-22)17(23)19-8-7-15(2)3/h15-16H,4-14H2,1-3H3,(H,19,23) |
| InChIKey | UREPZRFZGVXYOR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |