C26H23F2N3O5 — CID 42986361
3'-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 42986361) has the molecular formula C26H23F2N3O5 and a molecular weight of 495.48 g/mol. Its IUPAC name is 3'-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 42986361 |
| Molecular Formula | C26H23F2N3O5 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 3'-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)NC3(CCOc4ccccc43)C2=O)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C26H23F2N3O5/c1-15-13-19(16(2)31(15)17-7-9-18(10-8-17)36-24(27)28)21(32)14-30-23(33)26(29-25(30)34)11-12-35-22-6-4-3-5-20(22)26/h3-10,13,24H,11-12,14H2,1-2H3,(H,29,34) |
| InChIKey | YNHVUEAGWJUVQT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|