C22H20N4O6S — CID 42991101
3-[(4-methoxyphenyl)sulfamoyl]-N-[(E)-1-(3-nitrophenyl)ethylideneamino]benzamide (PubChem CID 42991101) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfamoyl]-N-[(E)-1-(3-nitrophenyl)ethylideneamino]benzamide.
| Compound Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-[(E)-1-(3-nitrophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 42991101 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-[(E)-1-(3-nitrophenyl)ethylideneamino]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)N/N=C(\C)c3cccc([N+](=O)[O-])c3)c2)cc1 |
| InChI | InChI=1S/C22H20N4O6S/c1-15(16-5-3-7-19(13-16)26(28)29)23-24-22(27)17-6-4-8-21(14-17)33(30,31)25-18-9-11-20(32-2)12-10-18/h3-14,25H,1-2H3,(H,24,27)/b23-15+ |
| InChIKey | PJDXUVMMKOGOBC-HZHRSRAPSA-N |
| XLogP | 3.56 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|