C26H25N5O2S — CID 42992113
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]acetamide (PubChem CID 42992113) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 42992113 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]acetamide |
| SMILES | CC(C)Oc1ccccc1/C=N/NC(=O)CSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H25N5O2S/c1-19(2)33-23-16-10-9-13-21(23)17-27-28-24(32)18-34-26-30-29-25(20-11-5-3-6-12-20)31(26)22-14-7-4-8-15-22/h3-17,19H,18H2,1-2H3,(H,28,32)/b27-17+ |
| InChIKey | YQTHVDYZSACXFH-WPWMEQJKSA-N |
| XLogP | 4.96 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|