C19H21N3O3S — CID 4299391
N-[4-[(1,2-dimethylindol-5-yl)methylsulfamoyl]phenyl]acetamide (PubChem CID 4299391) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[4-[(1,2-dimethylindol-5-yl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(1,2-dimethylindol-5-yl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4299391 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[4-[(1,2-dimethylindol-5-yl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ccc3c(c2)cc(C)n3C)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13-10-16-11-15(4-9-19(16)22(13)3)12-20-26(24,25)18-7-5-17(6-8-18)21-14(2)23/h4-11,20H,12H2,1-3H3,(H,21,23) |
| InChIKey | WXVMMMZUPCYHGP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |