C29H30N2O5 — CID 42995905
N-[2,5-diethoxy-4-[[2-(6-ethyl-1-benzofuran-3-yl)acetyl]amino]phenyl]benzamide (PubChem CID 42995905) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[2-(6-ethyl-1-benzofuran-3-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[[2-(6-ethyl-1-benzofuran-3-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 42995905 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[2,5-diethoxy-4-[[2-(6-ethyl-1-benzofuran-3-yl)acetyl]amino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)Cc1coc2cc(CC)ccc12 |
| InChI | InChI=1S/C29H30N2O5/c1-4-19-12-13-22-21(18-36-25(22)14-19)15-28(32)30-23-16-27(35-6-3)24(17-26(23)34-5-2)31-29(33)20-10-8-7-9-11-20/h7-14,16-18H,4-6,15H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | WUNKVOSEAZPGMP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |