C25H35N5O4 — CID 42999728
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-5-oxo-N-pentylpyrrolidine-3-carboxamide (PubChem CID 42999728) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-5-oxo-N-pentylpyrrolidine-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-5-oxo-N-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42999728 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-5-oxo-N-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCN(C(=O)C1CC(=O)N(Cc2ccccc2)C1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H35N5O4/c1-3-5-10-14-29(21-22(26)30(13-6-4-2)25(34)27-23(21)32)24(33)19-15-20(31)28(17-19)16-18-11-8-7-9-12-18/h7-9,11-12,19H,3-6,10,13-17,26H2,1-2H3,(H,27,32,34) |
| InChIKey | BYLQATLDSHFPEF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|