C27H39N5O4 — CID 55605539
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55605539) has the molecular formula C27H39N5O4 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55605539 |
| Molecular Formula | C27H39N5O4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | CCCCCN(C(=O)C1CCCN(C(=O)Cc2ccccc2)C1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H39N5O4/c1-3-5-10-17-31(23-24(28)32(16-6-4-2)27(36)29-25(23)34)26(35)21-14-11-15-30(19-21)22(33)18-20-12-8-7-9-13-20/h7-9,12-13,21H,3-6,10-11,14-19,28H2,1-2H3,(H,29,34,36) |
| InChIKey | PYHBCOYTRVNTNC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|