C24H33N5O4 — CID 55611535
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-5-oxo-N-pentyl-1-phenylpyrrolidine-3-carboxamide (PubChem CID 55611535) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-5-oxo-N-pentyl-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-5-oxo-N-pentyl-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55611535 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-5-oxo-N-pentyl-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CCCCCN(C(=O)C1CC(=O)N(c2ccccc2)C1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H33N5O4/c1-3-5-10-14-27(20-21(25)28(13-6-4-2)24(33)26-22(20)31)23(32)17-15-19(30)29(16-17)18-11-8-7-9-12-18/h7-9,11-12,17H,3-6,10,13-16,25H2,1-2H3,(H,26,31,33) |
| InChIKey | BVMNEDPSCZKVIX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|