C17H17Cl3N2O3S2 — CID 43000871
2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 43000871) has the molecular formula C17H17Cl3N2O3S2 and a molecular weight of 467.83 g/mol. Its IUPAC name is 2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 43000871 |
| Molecular Formula | C17H17Cl3N2O3S2 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(CSCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl3N2O3S2/c1-22(2)27(24,25)12-5-3-4-11(6-12)9-26-10-17(23)21-16-8-14(19)13(18)7-15(16)20/h3-8H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | XBRJIELSYYIPKY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|