C13H16Cl3N3 — CID 43005014
(E)-N-(4-methylpiperazin-1-yl)-1-(2,3,4-trichlorophenyl)ethanimine (PubChem CID 43005014) has the molecular formula C13H16Cl3N3 and a molecular weight of 320.65 g/mol. Its IUPAC name is (E)-N-(4-methylpiperazin-1-yl)-1-(2,3,4-trichlorophenyl)ethanimine.
| Compound Name | (E)-N-(4-methylpiperazin-1-yl)-1-(2,3,4-trichlorophenyl)ethanimine |
|---|---|
| PubChem CID | 43005014 |
| Molecular Formula | C13H16Cl3N3 |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (E)-N-(4-methylpiperazin-1-yl)-1-(2,3,4-trichlorophenyl)ethanimine |
| SMILES | C/C(=N\N1CCN(C)CC1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl3N3/c1-9(17-19-7-5-18(2)6-8-19)10-3-4-11(14)13(16)12(10)15/h3-4H,5-8H2,1-2H3/b17-9+ |
| InChIKey | INGATPDRCUHOAJ-RQZCQDPDSA-N |
| XLogP | 3.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|