C19H21FN4O4S2 — CID 43008061
ethyl 2-[[5-[[1-(4-fluorobenzoyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 43008061) has the molecular formula C19H21FN4O4S2 and a molecular weight of 452.53 g/mol. Its IUPAC name is ethyl 2-[[5-[[1-(4-fluorobenzoyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[1-(4-fluorobenzoyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 43008061 |
| Molecular Formula | C19H21FN4O4S2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | ethyl 2-[[5-[[1-(4-fluorobenzoyl)piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C19H21FN4O4S2/c1-2-28-15(25)11-29-19-23-22-18(30-19)21-16(26)12-7-9-24(10-8-12)17(27)13-3-5-14(20)6-4-13/h3-6,12H,2,7-11H2,1H3,(H,21,22,26) |
| InChIKey | OXWONBZDWFQYPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|