C26H37N3O3S — CID 43013321
2-[[1-(4-cyclohexylphenyl)-2-methylpropyl]amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 43013321) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is 2-[[1-(4-cyclohexylphenyl)-2-methylpropyl]amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[[1-(4-cyclohexylphenyl)-2-methylpropyl]amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43013321 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[[1-(4-cyclohexylphenyl)-2-methylpropyl]amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(C)C(NCC(=O)NCCc1ccc(S(N)(=O)=O)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H37N3O3S/c1-19(2)26(23-12-10-22(11-13-23)21-6-4-3-5-7-21)29-18-25(30)28-17-16-20-8-14-24(15-9-20)33(27,31)32/h8-15,19,21,26,29H,3-7,16-18H2,1-2H3,(H,28,30)(H2,27,31,32) |
| InChIKey | LXUXDWNTDGVRKH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |