C22H27N3O6 — CID 43014594
[1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 43014594) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 43014594 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OC(C)C(=O)NC(=O)NC3CCCC3)cc2C1=O |
| InChI | InChI=1S/C22H27N3O6/c1-3-4-11-25-19(27)16-10-9-14(12-17(16)20(25)28)21(29)31-13(2)18(26)24-22(30)23-15-7-5-6-8-15/h9-10,12-13,15H,3-8,11H2,1-2H3,(H2,23,24,26,30) |
| InChIKey | UDTYRFGZERNZQQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|