C24H25NO5 — CID 4637727
[1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4637727) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is [1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4637727 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OC(C)C(=O)c3ccc(CC)cc3)cc2C1=O |
| InChI | InChI=1S/C24H25NO5/c1-4-6-13-25-22(27)19-12-11-18(14-20(19)23(25)28)24(29)30-15(3)21(26)17-9-7-16(5-2)8-10-17/h7-12,14-15H,4-6,13H2,1-3H3 |
| InChIKey | WJLKSCMTUTUIPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|